C21H15N7 — CID 118529419
3,5-bis(5-phenyl-1H-1,2,4-triazol-3-yl)pyridine (PubChem CID 118529419) has the molecular formula C21H15N7 and a molecular weight of 365.40 g/mol. Its IUPAC name is 3,5-bis(5-phenyl-1H-1,2,4-triazol-3-yl)pyridine.
| Compound Name | 3,5-bis(5-phenyl-1H-1,2,4-triazol-3-yl)pyridine |
|---|---|
| PubChem CID | 118529419 |
| Molecular Formula | C21H15N7 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 3,5-bis(5-phenyl-1H-1,2,4-triazol-3-yl)pyridine |
| SMILES | c1ccc(-c2nc(-c3cncc(-c4n[nH]c(-c5ccccc5)n4)c3)n[nH]2)cc1 |
| InChI | InChI=1S/C21H15N7/c1-3-7-14(8-4-1)18-23-20(27-25-18)16-11-17(13-22-12-16)21-24-19(26-28-21)15-9-5-2-6-10-15/h1-13H,(H,23,25,27)(H,24,26,28) |
| InChIKey | MWZQHVVNKTXPMV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |