C30H34N8 — CID 118529717
4-[3-[3-[5-[4-(diethylamino)phenyl]-1H-1,2,4-triazol-3-yl]phenyl]-1H-1,2,4-triazol-5-yl]-N,N-diethylaniline (PubChem CID 118529717) has the molecular formula C30H34N8 and a molecular weight of 506.66 g/mol. Its IUPAC name is 4-[3-[3-[5-[4-(diethylamino)phenyl]-1H-1,2,4-triazol-3-yl]phenyl]-1H-1,2,4-triazol-5-yl]-N,N-diethylaniline.
| Compound Name | 4-[3-[3-[5-[4-(diethylamino)phenyl]-1H-1,2,4-triazol-3-yl]phenyl]-1H-1,2,4-triazol-5-yl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 118529717 |
| Molecular Formula | C30H34N8 |
| Molecular Weight | 506.66 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 4-[3-[3-[5-[4-(diethylamino)phenyl]-1H-1,2,4-triazol-3-yl]phenyl]-1H-1,2,4-triazol-5-yl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(-c2nc(-c3cccc(-c4n[nH]c(-c5ccc(N(CC)CC)cc5)n4)c3)n[nH]2)cc1 |
| InChI | InChI=1S/C30H34N8/c1-5-37(6-2)25-16-12-21(13-17-25)27-31-29(35-33-27)23-10-9-11-24(20-23)30-32-28(34-36-30)22-14-18-26(19-15-22)38(7-3)8-4/h9-20H,5-8H2,1-4H3,(H,31,33,35)(H,32,34,36) |
| InChIKey | XAZWFDAPMFSPPO-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.66 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |