C25H37NO6 — CID 118529917
(2S,3R,5R,10R,13R,14S,17S)-2,3,14-trihydroxy-10,13-dimethyl-17-(2-morpholin-4-ylacetyl)-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 118529917) has the molecular formula C25H37NO6 and a molecular weight of 447.57 g/mol. Its IUPAC name is (2S,3R,5R,10R,13R,14S,17S)-2,3,14-trihydroxy-10,13-dimethyl-17-(2-morpholin-4-ylacetyl)-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (2S,3R,5R,10R,13R,14S,17S)-2,3,14-trihydroxy-10,13-dimethyl-17-(2-morpholin-4-ylacetyl)-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 118529917 |
| Molecular Formula | C25H37NO6 |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | (2S,3R,5R,10R,13R,14S,17S)-2,3,14-trihydroxy-10,13-dimethyl-17-(2-morpholin-4-ylacetyl)-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | C[C@]12C[C@H](O)[C@H](O)C[C@H]1C(=O)C=C1C2CC[C@]2(C)[C@@H](C(=O)CN3CCOCC3)CC[C@@]12O |
| InChI | InChI=1S/C25H37NO6/c1-23-13-21(29)20(28)12-18(23)19(27)11-17-15(23)3-5-24(2)16(4-6-25(17,24)31)22(30)14-26-7-9-32-10-8-26/h11,15-16,18,20-21,28-29,31H,3-10,12-14H2,1-2H3/t15?,16-,18+,20-,21+,23-,24-,25-/m1/s1 |
| InChIKey | IJBKRALDQLSANX-DXWYVULCSA-N |
| XLogP | 1.09 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |