C24H38F2N2O4 — CID 118529957
(2S,3R,5R,6E,10R,13R,14S,17S)-17-[1-(2,2-difluoroethylamino)ethyl]-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol (PubChem CID 118529957) has the molecular formula C24H38F2N2O4 and a molecular weight of 456.57 g/mol. Its IUPAC name is (2S,3R,5R,6E,10R,13R,14S,17S)-17-[1-(2,2-difluoroethylamino)ethyl]-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol.
| Compound Name | (2S,3R,5R,6E,10R,13R,14S,17S)-17-[1-(2,2-difluoroethylamino)ethyl]-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol |
|---|---|
| PubChem CID | 118529957 |
| Molecular Formula | C24H38F2N2O4 |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | (2S,3R,5R,6E,10R,13R,14S,17S)-17-[1-(2,2-difluoroethylamino)ethyl]-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol |
| SMILES | CO/N=C1\C=C2C(CC[C@]3(C)[C@@H](C(C)NCC(F)F)CC[C@@]23O)[C@@]2(C)C[C@H](O)[C@H](O)C[C@@H]12 |
| InChI | InChI=1S/C24H38F2N2O4/c1-13(27-12-21(25)26)14-6-8-24(31)16-9-18(28-32-4)17-10-19(29)20(30)11-22(17,2)15(16)5-7-23(14,24)3/h9,13-15,17,19-21,27,29-31H,5-8,10-12H2,1-4H3/b28-18+/t13?,14-,15?,17+,19-,20+,22-,23-,24-/m1/s1 |
| InChIKey | XMQGVPFGFDASBV-VOYIJWMBSA-N |
| XLogP | 2.87 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|