C26H44N2O6 — CID 118529959
(2S,3R,5R,6E,10R,13R,14S,17S)-17-[1-(2,2-dimethoxyethylamino)ethyl]-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol (PubChem CID 118529959) has the molecular formula C26H44N2O6 and a molecular weight of 480.65 g/mol. Its IUPAC name is (2S,3R,5R,6E,10R,13R,14S,17S)-17-[1-(2,2-dimethoxyethylamino)ethyl]-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol.
| Compound Name | (2S,3R,5R,6E,10R,13R,14S,17S)-17-[1-(2,2-dimethoxyethylamino)ethyl]-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol |
|---|---|
| PubChem CID | 118529959 |
| Molecular Formula | C26H44N2O6 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | (2S,3R,5R,6E,10R,13R,14S,17S)-17-[1-(2,2-dimethoxyethylamino)ethyl]-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol |
| SMILES | CO/N=C1\C=C2C(CC[C@]3(C)[C@@H](C(C)NCC(OC)OC)CC[C@@]23O)[C@@]2(C)C[C@H](O)[C@H](O)C[C@@H]12 |
| InChI | InChI=1S/C26H44N2O6/c1-15(27-14-23(32-4)33-5)16-8-10-26(31)18-11-20(28-34-6)19-12-21(29)22(30)13-24(19,2)17(18)7-9-25(16,26)3/h11,15-17,19,21-23,27,29-31H,7-10,12-14H2,1-6H3/b28-20+/t15?,16-,17?,19+,21-,22+,24-,25-,26-/m1/s1 |
| InChIKey | DGDAHFHSRNDHBY-SRXDWBSESA-N |
| XLogP | 2.22 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|