C26H43NO6 — CID 118529982
(2S,3R,5R,10R,13R,14S,17S)-17-[1-[2,2-dimethoxyethyl(methyl)amino]ethyl]-2,3,14-trihydroxy-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 118529982) has the molecular formula C26H43NO6 and a molecular weight of 465.63 g/mol. Its IUPAC name is (2S,3R,5R,10R,13R,14S,17S)-17-[1-[2,2-dimethoxyethyl(methyl)amino]ethyl]-2,3,14-trihydroxy-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (2S,3R,5R,10R,13R,14S,17S)-17-[1-[2,2-dimethoxyethyl(methyl)amino]ethyl]-2,3,14-trihydroxy-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 118529982 |
| Molecular Formula | C26H43NO6 |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.31 |
| IUPAC Name | (2S,3R,5R,10R,13R,14S,17S)-17-[1-[2,2-dimethoxyethyl(methyl)amino]ethyl]-2,3,14-trihydroxy-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | COC(CN(C)C(C)[C@H]1CC[C@@]2(O)C3=CC(=O)[C@@H]4C[C@@H](O)[C@@H](O)C[C@]4(C)C3CC[C@]12C)OC |
| InChI | InChI=1S/C26H43NO6/c1-15(27(4)14-23(32-5)33-6)16-8-10-26(31)18-11-20(28)19-12-21(29)22(30)13-24(19,2)17(18)7-9-25(16,26)3/h11,15-17,19,21-23,29-31H,7-10,12-14H2,1-6H3/t15?,16-,17?,19+,21-,22+,24-,25-,26-/m1/s1 |
| InChIKey | LSVNKIWFNRCRDI-FWOBUDKESA-N |
| XLogP | 2.13 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|