C43H37O6P — CID 118530092
tert-butyl [2-[2-[(4,4,5,5-tetraphenyl-1,3,2-dioxaphospholan-2-yl)oxy]phenyl]phenyl] carbonate (PubChem CID 118530092) has the molecular formula C43H37O6P and a molecular weight of 680.74 g/mol. Its IUPAC name is tert-butyl [2-[2-[(4,4,5,5-tetraphenyl-1,3,2-dioxaphospholan-2-yl)oxy]phenyl]phenyl] carbonate.
| Compound Name | tert-butyl [2-[2-[(4,4,5,5-tetraphenyl-1,3,2-dioxaphospholan-2-yl)oxy]phenyl]phenyl] carbonate |
|---|---|
| PubChem CID | 118530092 |
| Molecular Formula | C43H37O6P |
| Molecular Weight | 680.74 g/mol |
| Exact Mass | 680.23 |
| IUPAC Name | tert-butyl [2-[2-[(4,4,5,5-tetraphenyl-1,3,2-dioxaphospholan-2-yl)oxy]phenyl]phenyl] carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1ccccc1-c1ccccc1OP1OC(c2ccccc2)(c2ccccc2)C(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C43H37O6P/c1-41(2,3)46-40(44)45-38-30-18-16-28-36(38)37-29-17-19-31-39(37)47-50-48-42(32-20-8-4-9-21-32,33-22-10-5-11-23-33)43(49-50,34-24-12-6-13-25-34)35-26-14-7-15-27-35/h4-31H,1-3H3 |
| InChIKey | CJMDMYANZKXJPJ-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.74 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|