C10H22N2O — CID 11853021
1-hydroxy-N,2,2,6,6-pentamethylpiperidin-4-amine (PubChem CID 11853021) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 1-hydroxy-N,2,2,6,6-pentamethylpiperidin-4-amine.
| Compound Name | 1-hydroxy-N,2,2,6,6-pentamethylpiperidin-4-amine |
|---|---|
| PubChem CID | 11853021 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 1-hydroxy-N,2,2,6,6-pentamethylpiperidin-4-amine |
| SMILES | CNC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C10H22N2O/c1-9(2)6-8(11-5)7-10(3,4)12(9)13/h8,11,13H,6-7H2,1-5H3 |
| InChIKey | ZIMUVQWVYRWGRC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |