C52H53N5S7 — CID 118530645
10-hexyl-2,7-bis[5-[2-(5-hexyl-1,3-thiazol-2-yl)-1,3-thiazol-5-yl]thiophen-2-yl]-[1]benzothiolo[3,2-b]indole (PubChem CID 118530645) has the molecular formula C52H53N5S7 and a molecular weight of 972.50 g/mol. Its IUPAC name is 10-hexyl-2,7-bis[5-[2-(5-hexyl-1,3-thiazol-2-yl)-1,3-thiazol-5-yl]thiophen-2-yl]-[1]benzothiolo[3,2-b]indole.
| Compound Name | 10-hexyl-2,7-bis[5-[2-(5-hexyl-1,3-thiazol-2-yl)-1,3-thiazol-5-yl]thiophen-2-yl]-[1]benzothiolo[3,2-b]indole |
|---|---|
| PubChem CID | 118530645 |
| Molecular Formula | C52H53N5S7 |
| Molecular Weight | 972.50 g/mol |
| Exact Mass | 971.23 |
| IUPAC Name | 10-hexyl-2,7-bis[5-[2-(5-hexyl-1,3-thiazol-2-yl)-1,3-thiazol-5-yl]thiophen-2-yl]-[1]benzothiolo[3,2-b]indole |
| SMILES | CCCCCCc1cnc(-c2ncc(-c3ccc(-c4ccc5c(c4)sc4c6ccc(-c7ccc(-c8cnc(-c9ncc(CCCCCC)s9)s8)s7)cc6n(CCCCCC)c54)s3)s2)s1 |
| InChI | InChI=1S/C52H53N5S7/c1-4-7-10-13-16-35-29-53-49(58-35)51-55-31-45(63-51)42-24-22-40(60-42)33-18-20-37-39(27-33)57(26-15-12-9-6-3)47-38-21-19-34(28-44(38)62-48(37)47)41-23-25-43(61-41)46-32-56-52(64-46)50-54-30-36(59-50)17-14-11-8-5-2/h18-25,27-32H,4-17,26H2,1-3H3 |
| InChIKey | AQHVWWGJFDHUOQ-UHFFFAOYSA-N |
| XLogP | 18.79 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 972.50 |
| LogP ≤ 5 | 18.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|