About 1-methyl-4,8-di(propan-2-yl)-6H-imidazo[4,5-f]benzotriazole
1-methyl-4,8-di(propan-2-yl)-6H-imidazo[4,5-f]benzotriazole (PubChem CID 118530666) has the molecular formula C14H19N5
and a molecular weight of 257.34 g/mol. Its IUPAC name is 1-methyl-4,8-di(propan-2-yl)-6H-imidazo[4,5-f]benzotriazole.
Molecular Properties
| Compound Name | 1-methyl-4,8-di(propan-2-yl)-6H-imidazo[4,5-f]benzotriazole |
| PubChem CID | 118530666 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 1-methyl-4,8-di(propan-2-yl)-6H-imidazo[4,5-f]benzotriazole |
| SMILES | CC(C)c1c2c(c(C(C)C)c3c1nnn3C)=NCN=2 |
| InChI | InChI=1S/C14H19N5/c1-7(2)9-11-12(16-6-15-11)10(8(3)4)14-13(9)17-18-19(14)5/h7-8H,6H2,1-5H3 |
| InChIKey | HSKKRVWUVWEUQG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-4,8-di(propan-2-yl)-6H-imidazo[4,5-f]benzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4,8-di(propan-2-yl)-6H-imidazo[4,5-f]benzotriazole?
The IUPAC name of 1-methyl-4,8-di(propan-2-yl)-6H-imidazo[4,5-f]benzotriazole (CID 118530666) is 1-methyl-4,8-di(propan-2-yl)-6H-imidazo[4,5-f]benzotriazole.
What is the SMILES notation for 1-methyl-4,8-di(propan-2-yl)-6H-imidazo[4,5-f]benzotriazole?
The canonical SMILES for 1-methyl-4,8-di(propan-2-yl)-6H-imidazo[4,5-f]benzotriazole is CC(C)c1c2c(c(C(C)C)c3c1nnn3C)=NCN=2.
What is the InChIKey of 1-methyl-4,8-di(propan-2-yl)-6H-imidazo[4,5-f]benzotriazole?
The InChIKey is HSKKRVWUVWEUQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5/c1-7(2)9-11-12(16-6-15-11)10(8(3)4)14-13(9)17-18-19(14)5/h7-8H,6H2,1-5H3.
What are the key properties of 1-methyl-4,8-di(propan-2-yl)-6H-imidazo[4,5-f]benzotriazole?
1-methyl-4,8-di(propan-2-yl)-6H-imidazo[4,5-f]benzotriazole has a molecular weight of 257.34 g/mol, XLogP of 1.43, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4,8-di(propan-2-yl)-6H-imidazo[4,5-f]benzotriazole is sourced from PubChem (CID 118530666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).