C28H36Cl3NO6S — CID 118531003
[2-(acetamidomethyl)-3-hydroxy-2-(hydroxymethyl)propyl] 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[2-(3,5-dichlorophenyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate (PubChem CID 118531003) has the molecular formula C28H36Cl3NO6S and a molecular weight of 621.02 g/mol. Its IUPAC name is [2-(acetamidomethyl)-3-hydroxy-2-(hydroxymethyl)propyl] 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[2-(3,5-dichlorophenyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate.
| Compound Name | [2-(acetamidomethyl)-3-hydroxy-2-(hydroxymethyl)propyl] 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[2-(3,5-dichlorophenyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 118531003 |
| Molecular Formula | C28H36Cl3NO6S |
| Molecular Weight | 621.02 g/mol |
| Exact Mass | 619.13 |
| IUPAC Name | [2-(acetamidomethyl)-3-hydroxy-2-(hydroxymethyl)propyl] 5-[3-[(1R,2R,3R,5R)-5-chloro-2-[2-(3,5-dichlorophenyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate |
| SMILES | CC(=O)NCC(CO)(CO)COC(=O)c1ccc(CCC[C@@H]2[C@@H](CCc3cc(Cl)cc(Cl)c3)[C@H](O)C[C@H]2Cl)s1 |
| InChI | InChI=1S/C28H36Cl3NO6S/c1-17(35)32-13-28(14-33,15-34)16-38-27(37)26-8-6-21(39-26)3-2-4-22-23(25(36)12-24(22)31)7-5-18-9-19(29)11-20(30)10-18/h6,8-11,22-25,33-34,36H,2-5,7,12-16H2,1H3,(H,32,35)/t22-,23-,24-,25-/m1/s1 |
| InChIKey | MHRZLDIISPFACD-ZGFBMJKBSA-N |
| XLogP | 4.88 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.02 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|