About ethyl 4-(3,3,3-trifluoro-2-methylpropanoyl)oxycyclohexane-1-carboxylate
ethyl 4-(3,3,3-trifluoro-2-methylpropanoyl)oxycyclohexane-1-carboxylate (PubChem CID 118531078) has the molecular formula C13H19F3O4
and a molecular weight of 296.29 g/mol. Its IUPAC name is ethyl 4-(3,3,3-trifluoro-2-methylpropanoyl)oxycyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(3,3,3-trifluoro-2-methylpropanoyl)oxycyclohexane-1-carboxylate |
| PubChem CID | 118531078 |
| Molecular Formula | C13H19F3O4 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | ethyl 4-(3,3,3-trifluoro-2-methylpropanoyl)oxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(OC(=O)C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H19F3O4/c1-3-19-12(18)9-4-6-10(7-5-9)20-11(17)8(2)13(14,15)16/h8-10H,3-7H2,1-2H3 |
| InChIKey | XOIJBUSCRBWVTP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-(3,3,3-trifluoro-2-methylpropanoyl)oxycyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(3,3,3-trifluoro-2-methylpropanoyl)oxycyclohexane-1-carboxylate?
The IUPAC name of ethyl 4-(3,3,3-trifluoro-2-methylpropanoyl)oxycyclohexane-1-carboxylate (CID 118531078) is ethyl 4-(3,3,3-trifluoro-2-methylpropanoyl)oxycyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 4-(3,3,3-trifluoro-2-methylpropanoyl)oxycyclohexane-1-carboxylate?
The canonical SMILES for ethyl 4-(3,3,3-trifluoro-2-methylpropanoyl)oxycyclohexane-1-carboxylate is CCOC(=O)C1CCC(OC(=O)C(C)C(F)(F)F)CC1.
What is the InChIKey of ethyl 4-(3,3,3-trifluoro-2-methylpropanoyl)oxycyclohexane-1-carboxylate?
The InChIKey is XOIJBUSCRBWVTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F3O4/c1-3-19-12(18)9-4-6-10(7-5-9)20-11(17)8(2)13(14,15)16/h8-10H,3-7H2,1-2H3.
What are the key properties of ethyl 4-(3,3,3-trifluoro-2-methylpropanoyl)oxycyclohexane-1-carboxylate?
ethyl 4-(3,3,3-trifluoro-2-methylpropanoyl)oxycyclohexane-1-carboxylate has a molecular weight of 296.29 g/mol, XLogP of 2.85, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(3,3,3-trifluoro-2-methylpropanoyl)oxycyclohexane-1-carboxylate is sourced from PubChem (CID 118531078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).