C17H30F2N2 — CID 118531454
(3aS,6aR)-5-tert-butyl-2-[(4,4-difluorocyclohexyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 118531454) has the molecular formula C17H30F2N2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (3aS,6aR)-5-tert-butyl-2-[(4,4-difluorocyclohexyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | (3aS,6aR)-5-tert-butyl-2-[(4,4-difluorocyclohexyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 118531454 |
| Molecular Formula | C17H30F2N2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.24 |
| IUPAC Name | (3aS,6aR)-5-tert-butyl-2-[(4,4-difluorocyclohexyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC(C)(C)N1C[C@H]2CN(CC3CCC(F)(F)CC3)C[C@H]2C1 |
| InChI | InChI=1S/C17H30F2N2/c1-16(2,3)21-11-14-9-20(10-15(14)12-21)8-13-4-6-17(18,19)7-5-13/h13-15H,4-12H2,1-3H3/t14-,15+ |
| InChIKey | CGVBEEZODQHOCN-GASCZTMLSA-N |
| XLogP | 3.47 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |