C14H28N2 — CID 118531456
(3aR,7aR)-2-tert-butyl-3a,5,7a-trimethyl-3,4,6,7-tetrahydro-1H-pyrrolo[3,4-c]pyridine (PubChem CID 118531456) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is (3aR,7aR)-2-tert-butyl-3a,5,7a-trimethyl-3,4,6,7-tetrahydro-1H-pyrrolo[3,4-c]pyridine.
| Compound Name | (3aR,7aR)-2-tert-butyl-3a,5,7a-trimethyl-3,4,6,7-tetrahydro-1H-pyrrolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 118531456 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | (3aR,7aR)-2-tert-butyl-3a,5,7a-trimethyl-3,4,6,7-tetrahydro-1H-pyrrolo[3,4-c]pyridine |
| SMILES | CN1CC[C@@]2(C)CN(C(C)(C)C)C[C@@]2(C)C1 |
| InChI | InChI=1S/C14H28N2/c1-12(2,3)16-10-13(4)7-8-15(6)9-14(13,5)11-16/h7-11H2,1-6H3/t13-,14+/m0/s1 |
| InChIKey | BKRCJCHREBFOBN-UONOGXRCSA-N |
| XLogP | 2.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |