C12H21F3N2 — CID 118531461
(3aR,6aS)-5-tert-butyl-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 118531461) has the molecular formula C12H21F3N2 and a molecular weight of 250.31 g/mol. Its IUPAC name is (3aR,6aS)-5-tert-butyl-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-5-tert-butyl-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 118531461 |
| Molecular Formula | C12H21F3N2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (3aR,6aS)-5-tert-butyl-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC(C)(C)N1C[C@H]2CN(CC(F)(F)F)C[C@H]2C1 |
| InChI | InChI=1S/C12H21F3N2/c1-11(2,3)17-6-9-4-16(5-10(9)7-17)8-12(13,14)15/h9-10H,4-8H2,1-3H3/t9-,10+ |
| InChIKey | VDEVLUAPCSCLKT-AOOOYVTPSA-N |
| XLogP | 2.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |