C15H30N2O — CID 118531481
4-[(3aS,6aR)-5-tert-butyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-methylbutan-2-ol (PubChem CID 118531481) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 4-[(3aS,6aR)-5-tert-butyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-methylbutan-2-ol.
| Compound Name | 4-[(3aS,6aR)-5-tert-butyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 118531481 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 4-[(3aS,6aR)-5-tert-butyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-methylbutan-2-ol |
| SMILES | CC(C)(O)CCN1C[C@@H]2CN(C(C)(C)C)C[C@@H]2C1 |
| InChI | InChI=1S/C15H30N2O/c1-14(2,3)17-10-12-8-16(9-13(12)11-17)7-6-15(4,5)18/h12-13,18H,6-11H2,1-5H3/t12-,13+ |
| InChIKey | JWMWUGPOFFEFOW-BETUJISGSA-N |
| XLogP | 1.81 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |