About methyl N-[(3R,4S,5S)-3-amino-1-tert-butyl-5-methylpiperidin-4-yl]-N-methylcarbamate
methyl N-[(3R,4S,5S)-3-amino-1-tert-butyl-5-methylpiperidin-4-yl]-N-methylcarbamate (PubChem CID 118531742) has the molecular formula C13H27N3O2
and a molecular weight of 257.38 g/mol. Its IUPAC name is methyl N-[(3R,4S,5S)-3-amino-1-tert-butyl-5-methylpiperidin-4-yl]-N-methylcarbamate.
Molecular Properties
| Compound Name | methyl N-[(3R,4S,5S)-3-amino-1-tert-butyl-5-methylpiperidin-4-yl]-N-methylcarbamate |
| PubChem CID | 118531742 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | methyl N-[(3R,4S,5S)-3-amino-1-tert-butyl-5-methylpiperidin-4-yl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)[C@@H]1[C@H](N)CN(C(C)(C)C)C[C@@H]1C |
| InChI | InChI=1S/C13H27N3O2/c1-9-7-16(13(2,3)4)8-10(14)11(9)15(5)12(17)18-6/h9-11H,7-8,14H2,1-6H3/t9-,10+,11-/m0/s1 |
| InChIKey | GOPQKIHYSUEQBC-AXFHLTTASA-N |
| XLogP | 1.13 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl N-[(3R,4S,5S)-3-amino-1-tert-butyl-5-methylpiperidin-4-yl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(3R,4S,5S)-3-amino-1-tert-butyl-5-methylpiperidin-4-yl]-N-methylcarbamate?
The IUPAC name of methyl N-[(3R,4S,5S)-3-amino-1-tert-butyl-5-methylpiperidin-4-yl]-N-methylcarbamate (CID 118531742) is methyl N-[(3R,4S,5S)-3-amino-1-tert-butyl-5-methylpiperidin-4-yl]-N-methylcarbamate.
What is the SMILES notation for methyl N-[(3R,4S,5S)-3-amino-1-tert-butyl-5-methylpiperidin-4-yl]-N-methylcarbamate?
The canonical SMILES for methyl N-[(3R,4S,5S)-3-amino-1-tert-butyl-5-methylpiperidin-4-yl]-N-methylcarbamate is COC(=O)N(C)[C@@H]1[C@H](N)CN(C(C)(C)C)C[C@@H]1C.
What is the InChIKey of methyl N-[(3R,4S,5S)-3-amino-1-tert-butyl-5-methylpiperidin-4-yl]-N-methylcarbamate?
The InChIKey is GOPQKIHYSUEQBC-AXFHLTTASA-N. The full InChI is InChI=1S/C13H27N3O2/c1-9-7-16(13(2,3)4)8-10(14)11(9)15(5)12(17)18-6/h9-11H,7-8,14H2,1-6H3/t9-,10+,11-/m0/s1.
What are the key properties of methyl N-[(3R,4S,5S)-3-amino-1-tert-butyl-5-methylpiperidin-4-yl]-N-methylcarbamate?
methyl N-[(3R,4S,5S)-3-amino-1-tert-butyl-5-methylpiperidin-4-yl]-N-methylcarbamate has a molecular weight of 257.38 g/mol, XLogP of 1.13, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(3R,4S,5S)-3-amino-1-tert-butyl-5-methylpiperidin-4-yl]-N-methylcarbamate is sourced from PubChem (CID 118531742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).