C41H26N4OS — CID 118531839
2-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]-5-phenyl-[1,3]thiazolo[4,5-b]phenoxazine (PubChem CID 118531839) has the molecular formula C41H26N4OS and a molecular weight of 622.75 g/mol. Its IUPAC name is 2-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]-5-phenyl-[1,3]thiazolo[4,5-b]phenoxazine.
| Compound Name | 2-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]-5-phenyl-[1,3]thiazolo[4,5-b]phenoxazine |
|---|---|
| PubChem CID | 118531839 |
| Molecular Formula | C41H26N4OS |
| Molecular Weight | 622.75 g/mol |
| Exact Mass | 622.18 |
| IUPAC Name | 2-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]-5-phenyl-[1,3]thiazolo[4,5-b]phenoxazine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3ccc(-c4nc5cc6c(cc5s4)Oc4ccccc4N6c4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C41H26N4OS/c1-4-12-27(13-5-1)32-24-33(28-14-6-2-7-15-28)43-40(42-32)29-20-22-30(23-21-29)41-44-34-25-36-38(26-39(34)47-41)46-37-19-11-10-18-35(37)45(36)31-16-8-3-9-17-31/h1-26H |
| InChIKey | LSYAVKUUMGMTMV-UHFFFAOYSA-N |
| XLogP | 11.33 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.75 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |