C34H21N5OS — CID 118531845
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-phenyl-[1,3]thiazolo[5,4-b]phenoxazine (PubChem CID 118531845) has the molecular formula C34H21N5OS and a molecular weight of 547.64 g/mol. Its IUPAC name is 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-phenyl-[1,3]thiazolo[5,4-b]phenoxazine.
| Compound Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-phenyl-[1,3]thiazolo[5,4-b]phenoxazine |
|---|---|
| PubChem CID | 118531845 |
| Molecular Formula | C34H21N5OS |
| Molecular Weight | 547.64 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-phenyl-[1,3]thiazolo[5,4-b]phenoxazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3nc4cc5c(cc4s3)N(c3ccccc3)c3ccccc3O5)n2)cc1 |
| InChI | InChI=1S/C34H21N5OS/c1-4-12-22(13-5-1)31-36-32(23-14-6-2-7-15-23)38-33(37-31)34-35-25-20-29-27(21-30(25)41-34)39(24-16-8-3-9-17-24)26-18-10-11-19-28(26)40-29/h1-21H |
| InChIKey | AGRGSFSHZKFSAS-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 64.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.64 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |