About 2-propan-2-yl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole
2-propan-2-yl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole (PubChem CID 118532319) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 2-propan-2-yl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole.
Molecular Properties
| Compound Name | 2-propan-2-yl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole |
| PubChem CID | 118532319 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 2-propan-2-yl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole |
| SMILES | CC(C)C1=NC2=C(CCC2)C1 |
| InChI | InChI=1S/C10H15N/c1-7(2)10-6-8-4-3-5-9(8)11-10/h7H,3-6H2,1-2H3 |
| InChIKey | NIVYJMPXTTUGKO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-propan-2-yl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole?
The IUPAC name of 2-propan-2-yl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole (CID 118532319) is 2-propan-2-yl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole.
What is the SMILES notation for 2-propan-2-yl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole?
The canonical SMILES for 2-propan-2-yl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole is CC(C)C1=NC2=C(CCC2)C1.
What is the InChIKey of 2-propan-2-yl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole?
The InChIKey is NIVYJMPXTTUGKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-7(2)10-6-8-4-3-5-9(8)11-10/h7H,3-6H2,1-2H3.
What are the key properties of 2-propan-2-yl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole?
2-propan-2-yl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole has a molecular weight of 149.24 g/mol, XLogP of 2.93, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-3,4,5,6-tetrahydrocyclopenta[b]pyrrole is sourced from PubChem (CID 118532319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).