C26H19N5O2S — CID 118532349
3-N-[7-(benzenesulfonyl)-6-(2-phenylethynyl)pyrrolo[2,3-d]pyrimidin-4-yl]benzene-1,3-diamine (PubChem CID 118532349) has the molecular formula C26H19N5O2S and a molecular weight of 465.54 g/mol. Its IUPAC name is 3-N-[7-(benzenesulfonyl)-6-(2-phenylethynyl)pyrrolo[2,3-d]pyrimidin-4-yl]benzene-1,3-diamine.
| Compound Name | 3-N-[7-(benzenesulfonyl)-6-(2-phenylethynyl)pyrrolo[2,3-d]pyrimidin-4-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 118532349 |
| Molecular Formula | C26H19N5O2S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 3-N-[7-(benzenesulfonyl)-6-(2-phenylethynyl)pyrrolo[2,3-d]pyrimidin-4-yl]benzene-1,3-diamine |
| SMILES | Nc1cccc(Nc2ncnc3c2cc(C#Cc2ccccc2)n3S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C26H19N5O2S/c27-20-10-7-11-21(16-20)30-25-24-17-22(15-14-19-8-3-1-4-9-19)31(26(24)29-18-28-25)34(32,33)23-12-5-2-6-13-23/h1-13,16-18H,27H2,(H,28,29,30) |
| InChIKey | CCDUPTRBHXMBQF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|