C19H15Br — CID 118532943
9-bromo-7,7-dimethylbenzo[a]phenalene (PubChem CID 118532943) has the molecular formula C19H15Br and a molecular weight of 323.23 g/mol. Its IUPAC name is 9-bromo-7,7-dimethylbenzo[a]phenalene.
| Compound Name | 9-bromo-7,7-dimethylbenzo[a]phenalene |
|---|---|
| PubChem CID | 118532943 |
| Molecular Formula | C19H15Br |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 9-bromo-7,7-dimethylbenzo[a]phenalene |
| SMILES | CC1(C)c2cc(Br)ccc2-c2cccc3cccc1c23 |
| InChI | InChI=1S/C19H15Br/c1-19(2)16-8-4-6-12-5-3-7-15(18(12)16)14-10-9-13(20)11-17(14)19/h3-11H,1-2H3 |
| InChIKey | OFAIVSCXKJAXHT-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |