About 3-methylbutan-2-yl N-ethenylmethanimidothioate
3-methylbutan-2-yl N-ethenylmethanimidothioate (PubChem CID 118533076) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is 3-methylbutan-2-yl N-ethenylmethanimidothioate.
Molecular Properties
| Compound Name | 3-methylbutan-2-yl N-ethenylmethanimidothioate |
| PubChem CID | 118533076 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 3-methylbutan-2-yl N-ethenylmethanimidothioate |
| SMILES | C=C/N=C/SC(C)C(C)C |
| InChI | InChI=1S/C8H15NS/c1-5-9-6-10-8(4)7(2)3/h5-8H,1H2,2-4H3/b9-6+ |
| InChIKey | PHLNCAJVKPHYEU-RMKNXTFCSA-N |
| XLogP | 2.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutan-2-yl N-ethenylmethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-2-yl N-ethenylmethanimidothioate?
The IUPAC name of 3-methylbutan-2-yl N-ethenylmethanimidothioate (CID 118533076) is 3-methylbutan-2-yl N-ethenylmethanimidothioate.
What is the SMILES notation for 3-methylbutan-2-yl N-ethenylmethanimidothioate?
The canonical SMILES for 3-methylbutan-2-yl N-ethenylmethanimidothioate is C=C/N=C/SC(C)C(C)C.
What is the InChIKey of 3-methylbutan-2-yl N-ethenylmethanimidothioate?
The InChIKey is PHLNCAJVKPHYEU-RMKNXTFCSA-N. The full InChI is InChI=1S/C8H15NS/c1-5-9-6-10-8(4)7(2)3/h5-8H,1H2,2-4H3/b9-6+.
What are the key properties of 3-methylbutan-2-yl N-ethenylmethanimidothioate?
3-methylbutan-2-yl N-ethenylmethanimidothioate has a molecular weight of 157.28 g/mol, XLogP of 2.94, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-2-yl N-ethenylmethanimidothioate is sourced from PubChem (CID 118533076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).