C25H28N2O2 — CID 11853327
(3S)-2-[(2E,4E)-hexa-2,4-dienoyl]-N-(2,4,6-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 11853327) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is (3S)-2-[(2E,4E)-hexa-2,4-dienoyl]-N-(2,4,6-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S)-2-[(2E,4E)-hexa-2,4-dienoyl]-N-(2,4,6-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 11853327 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (3S)-2-[(2E,4E)-hexa-2,4-dienoyl]-N-(2,4,6-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | C/C=C/C=C/C(=O)N1Cc2ccccc2C[C@H]1C(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C25H28N2O2/c1-5-6-7-12-23(28)27-16-21-11-9-8-10-20(21)15-22(27)25(29)26-24-18(3)13-17(2)14-19(24)4/h5-14,22H,15-16H2,1-4H3,(H,26,29)/b6-5+,12-7+/t22-/m0/s1 |
| InChIKey | REBOHOFVKAVVBX-OUICJDCTSA-N |
| XLogP | 4.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|