C32H31F3N6O3 — CID 118533407
5-[3-(tert-butylcarbamoyl)phenyl]-N-methyl-2-[4-(5-methyl-1,2,4-triazol-1-yl)phenyl]-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide (PubChem CID 118533407) has the molecular formula C32H31F3N6O3 and a molecular weight of 604.63 g/mol. Its IUPAC name is 5-[3-(tert-butylcarbamoyl)phenyl]-N-methyl-2-[4-(5-methyl-1,2,4-triazol-1-yl)phenyl]-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 5-[3-(tert-butylcarbamoyl)phenyl]-N-methyl-2-[4-(5-methyl-1,2,4-triazol-1-yl)phenyl]-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118533407 |
| Molecular Formula | C32H31F3N6O3 |
| Molecular Weight | 604.63 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | 5-[3-(tert-butylcarbamoyl)phenyl]-N-methyl-2-[4-(5-methyl-1,2,4-triazol-1-yl)phenyl]-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(-n3ncnc3C)cc2)oc2nc(CCC(F)(F)F)c(-c3cccc(C(=O)NC(C)(C)C)c3)cc12 |
| InChI | InChI=1S/C32H31F3N6O3/c1-18-37-17-38-41(18)22-11-9-19(10-12-22)27-26(29(43)36-5)24-16-23(25(39-30(24)44-27)13-14-32(33,34)35)20-7-6-8-21(15-20)28(42)40-31(2,3)4/h6-12,15-17H,13-14H2,1-5H3,(H,36,43)(H,40,42) |
| InChIKey | OYAYGZRBBZCJIF-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.63 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |