C11H21N3O — CID 118533449
(3aR,6aS)-2-[(3-methyloxetan-3-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-amine (PubChem CID 118533449) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is (3aR,6aS)-2-[(3-methyloxetan-3-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-amine.
| Compound Name | (3aR,6aS)-2-[(3-methyloxetan-3-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-amine |
|---|---|
| PubChem CID | 118533449 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | (3aR,6aS)-2-[(3-methyloxetan-3-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-amine |
| SMILES | CC1(CN2C[C@H]3CN(N)C[C@H]3C2)COC1 |
| InChI | InChI=1S/C11H21N3O/c1-11(7-15-8-11)6-13-2-9-4-14(12)5-10(9)3-13/h9-10H,2-8,12H2,1H3/t9-,10+ |
| InChIKey | OWZVYLNDEAFGKM-AOOOYVTPSA-N |
| XLogP | -0.24 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|