About 3-[3-[3-fluoro-5-(2-methylpropoxy)phenyl]phenyl]-3-(1,3-thiazol-2-yl)propanoic acid
3-[3-[3-fluoro-5-(2-methylpropoxy)phenyl]phenyl]-3-(1,3-thiazol-2-yl)propanoic acid (PubChem CID 118533537) has the molecular formula C22H22FNO3S
and a molecular weight of 399.49 g/mol. Its IUPAC name is 3-[3-[3-fluoro-5-(2-methylpropoxy)phenyl]phenyl]-3-(1,3-thiazol-2-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-[3-[3-fluoro-5-(2-methylpropoxy)phenyl]phenyl]-3-(1,3-thiazol-2-yl)propanoic acid |
| PubChem CID | 118533537 |
| Molecular Formula | C22H22FNO3S |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 3-[3-[3-fluoro-5-(2-methylpropoxy)phenyl]phenyl]-3-(1,3-thiazol-2-yl)propanoic acid |
| SMILES | CC(C)COc1cc(F)cc(-c2cccc(C(CC(=O)O)c3nccs3)c2)c1 |
| InChI | InChI=1S/C22H22FNO3S/c1-14(2)13-27-19-10-17(9-18(23)11-19)15-4-3-5-16(8-15)20(12-21(25)26)22-24-6-7-28-22/h3-11,14,20H,12-13H2,1-2H3,(H,25,26) |
| InChIKey | HYURQHQFDOOKQA-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3-[3-fluoro-5-(2-methylpropoxy)phenyl]phenyl]-3-(1,3-thiazol-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[3-fluoro-5-(2-methylpropoxy)phenyl]phenyl]-3-(1,3-thiazol-2-yl)propanoic acid?
The IUPAC name of 3-[3-[3-fluoro-5-(2-methylpropoxy)phenyl]phenyl]-3-(1,3-thiazol-2-yl)propanoic acid (CID 118533537) is 3-[3-[3-fluoro-5-(2-methylpropoxy)phenyl]phenyl]-3-(1,3-thiazol-2-yl)propanoic acid.
What is the SMILES notation for 3-[3-[3-fluoro-5-(2-methylpropoxy)phenyl]phenyl]-3-(1,3-thiazol-2-yl)propanoic acid?
The canonical SMILES for 3-[3-[3-fluoro-5-(2-methylpropoxy)phenyl]phenyl]-3-(1,3-thiazol-2-yl)propanoic acid is CC(C)COc1cc(F)cc(-c2cccc(C(CC(=O)O)c3nccs3)c2)c1.
What is the InChIKey of 3-[3-[3-fluoro-5-(2-methylpropoxy)phenyl]phenyl]-3-(1,3-thiazol-2-yl)propanoic acid?
The InChIKey is HYURQHQFDOOKQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22FNO3S/c1-14(2)13-27-19-10-17(9-18(23)11-19)15-4-3-5-16(8-15)20(12-21(25)26)22-24-6-7-28-22/h3-11,14,20H,12-13H2,1-2H3,(H,25,26).
What are the key properties of 3-[3-[3-fluoro-5-(2-methylpropoxy)phenyl]phenyl]-3-(1,3-thiazol-2-yl)propanoic acid?
3-[3-[3-fluoro-5-(2-methylpropoxy)phenyl]phenyl]-3-(1,3-thiazol-2-yl)propanoic acid has a molecular weight of 399.49 g/mol, XLogP of 5.59, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[3-fluoro-5-(2-methylpropoxy)phenyl]phenyl]-3-(1,3-thiazol-2-yl)propanoic acid is sourced from PubChem (CID 118533537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).