About 3-[3-fluoro-5-(2-fluoro-5-methylphenyl)phenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid
3-[3-fluoro-5-(2-fluoro-5-methylphenyl)phenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid (PubChem CID 118533580) has the molecular formula C20H17F2NO2S
and a molecular weight of 373.42 g/mol. Its IUPAC name is 3-[3-fluoro-5-(2-fluoro-5-methylphenyl)phenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-[3-fluoro-5-(2-fluoro-5-methylphenyl)phenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid |
| PubChem CID | 118533580 |
| Molecular Formula | C20H17F2NO2S |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 3-[3-fluoro-5-(2-fluoro-5-methylphenyl)phenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid |
| SMILES | Cc1ccc(F)c(-c2cc(F)cc(C(CC(=O)O)c3ncc(C)s3)c2)c1 |
| InChI | InChI=1S/C20H17F2NO2S/c1-11-3-4-18(22)16(5-11)13-6-14(8-15(21)7-13)17(9-19(24)25)20-23-10-12(2)26-20/h3-8,10,17H,9H2,1-2H3,(H,24,25) |
| InChIKey | NCODPLDIOQOJOU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-fluoro-5-(2-fluoro-5-methylphenyl)phenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-fluoro-5-(2-fluoro-5-methylphenyl)phenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid?
The IUPAC name of 3-[3-fluoro-5-(2-fluoro-5-methylphenyl)phenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid (CID 118533580) is 3-[3-fluoro-5-(2-fluoro-5-methylphenyl)phenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid.
What is the SMILES notation for 3-[3-fluoro-5-(2-fluoro-5-methylphenyl)phenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid?
The canonical SMILES for 3-[3-fluoro-5-(2-fluoro-5-methylphenyl)phenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid is Cc1ccc(F)c(-c2cc(F)cc(C(CC(=O)O)c3ncc(C)s3)c2)c1.
What is the InChIKey of 3-[3-fluoro-5-(2-fluoro-5-methylphenyl)phenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid?
The InChIKey is NCODPLDIOQOJOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F2NO2S/c1-11-3-4-18(22)16(5-11)13-6-14(8-15(21)7-13)17(9-19(24)25)20-23-10-12(2)26-20/h3-8,10,17H,9H2,1-2H3,(H,24,25).
What are the key properties of 3-[3-fluoro-5-(2-fluoro-5-methylphenyl)phenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid?
3-[3-fluoro-5-(2-fluoro-5-methylphenyl)phenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid has a molecular weight of 373.42 g/mol, XLogP of 5.31, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-fluoro-5-(2-fluoro-5-methylphenyl)phenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid is sourced from PubChem (CID 118533580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).