C30H40N6 — CID 11853379
(4aR,10bS)-1-[[5-(4-piperidin-1-ylpiperidin-1-yl)imidazo[1,2-a]pyridin-2-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline (PubChem CID 11853379) has the molecular formula C30H40N6 and a molecular weight of 484.69 g/mol. Its IUPAC name is (4aR,10bS)-1-[[5-(4-piperidin-1-ylpiperidin-1-yl)imidazo[1,2-a]pyridin-2-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline.
| Compound Name | (4aR,10bS)-1-[[5-(4-piperidin-1-ylpiperidin-1-yl)imidazo[1,2-a]pyridin-2-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline |
|---|---|
| PubChem CID | 11853379 |
| Molecular Formula | C30H40N6 |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.33 |
| IUPAC Name | (4aR,10bS)-1-[[5-(4-piperidin-1-ylpiperidin-1-yl)imidazo[1,2-a]pyridin-2-yl]methyl]-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthroline |
| SMILES | c1cnc2c(c1)CC[C@@H]1CCCN(Cc3cn4c(N5CCC(N6CCCCC6)CC5)cccc4n3)[C@H]21 |
| InChI | InChI=1S/C30H40N6/c1-2-16-33(17-3-1)26-13-19-34(20-14-26)28-10-4-9-27-32-25(22-36(27)28)21-35-18-6-8-24-12-11-23-7-5-15-31-29(23)30(24)35/h4-5,7,9-10,15,22,24,26,30H,1-3,6,8,11-14,16-21H2/t24-,30-/m0/s1 |
| InChIKey | HWQIPHRZSKOATK-NGQVCNFZSA-N |
| XLogP | 5.08 |
| TPSA | 39.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |