C27H36N6 — CID 11853382
2-[[(4aR,10bS)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]-N-methyl-N-(1-methylpiperidin-4-yl)imidazo[1,2-a]pyridin-5-amine (PubChem CID 11853382) has the molecular formula C27H36N6 and a molecular weight of 444.63 g/mol. Its IUPAC name is 2-[[(4aR,10bS)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]-N-methyl-N-(1-methylpiperidin-4-yl)imidazo[1,2-a]pyridin-5-amine.
| Compound Name | 2-[[(4aR,10bS)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]-N-methyl-N-(1-methylpiperidin-4-yl)imidazo[1,2-a]pyridin-5-amine |
|---|---|
| PubChem CID | 11853382 |
| Molecular Formula | C27H36N6 |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | 2-[[(4aR,10bS)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]-N-methyl-N-(1-methylpiperidin-4-yl)imidazo[1,2-a]pyridin-5-amine |
| SMILES | CN1CCC(N(C)c2cccc3nc(CN4CCC[C@H]5CCc6cccnc6[C@H]54)cn23)CC1 |
| InChI | InChI=1S/C27H36N6/c1-30-16-12-23(13-17-30)31(2)25-9-3-8-24-29-22(19-33(24)25)18-32-15-5-7-21-11-10-20-6-4-14-28-26(20)27(21)32/h3-4,6,8-9,14,19,21,23,27H,5,7,10-13,15-18H2,1-2H3/t21-,27-/m0/s1 |
| InChIKey | MCUQDGOWDVSXPT-IDISGSTGSA-N |
| XLogP | 4.16 |
| TPSA | 39.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |