C18H15BrClN3O2 — CID 118533960
methyl N-[[5-[3-(3-bromophenyl)pyrazol-1-yl]-2-chlorophenyl]methyl]carbamate (PubChem CID 118533960) has the molecular formula C18H15BrClN3O2 and a molecular weight of 420.69 g/mol. Its IUPAC name is methyl N-[[5-[3-(3-bromophenyl)pyrazol-1-yl]-2-chlorophenyl]methyl]carbamate.
| Compound Name | methyl N-[[5-[3-(3-bromophenyl)pyrazol-1-yl]-2-chlorophenyl]methyl]carbamate |
|---|---|
| PubChem CID | 118533960 |
| Molecular Formula | C18H15BrClN3O2 |
| Molecular Weight | 420.69 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | methyl N-[[5-[3-(3-bromophenyl)pyrazol-1-yl]-2-chlorophenyl]methyl]carbamate |
| SMILES | COC(=O)NCc1cc(-n2ccc(-c3cccc(Br)c3)n2)ccc1Cl |
| InChI | InChI=1S/C18H15BrClN3O2/c1-25-18(24)21-11-13-10-15(5-6-16(13)20)23-8-7-17(22-23)12-3-2-4-14(19)9-12/h2-10H,11H2,1H3,(H,21,24) |
| InChIKey | NNMYTEWSEZHDFD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.69 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |