C16H17N3 — CID 118534163
3-methyl-2,6-diphenyl-2,4-dihydro-1H-1,3,5-triazine (PubChem CID 118534163) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-methyl-2,6-diphenyl-2,4-dihydro-1H-1,3,5-triazine.
| Compound Name | 3-methyl-2,6-diphenyl-2,4-dihydro-1H-1,3,5-triazine |
|---|---|
| PubChem CID | 118534163 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 3-methyl-2,6-diphenyl-2,4-dihydro-1H-1,3,5-triazine |
| SMILES | CN1CN=C(c2ccccc2)NC1c1ccccc1 |
| InChI | InChI=1S/C16H17N3/c1-19-12-17-15(13-8-4-2-5-9-13)18-16(19)14-10-6-3-7-11-14/h2-11,16H,12H2,1H3,(H,17,18) |
| InChIKey | AKOQMRUYBLJEKI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |