C49H55N7O5 — CID 118534797
4-[[4-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenoxy]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]benzoic acid (PubChem CID 118534797) has the molecular formula C49H55N7O5 and a molecular weight of 822.02 g/mol. Its IUPAC name is 4-[[4-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenoxy]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[4-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenoxy]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 118534797 |
| Molecular Formula | C49H55N7O5 |
| Molecular Weight | 822.02 g/mol |
| Exact Mass | 821.43 |
| IUPAC Name | 4-[[4-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenoxy]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]benzoic acid |
| SMILES | CC(C)(C)OC(=O)N(CCCCOc1cc(CN(Cc2ccccn2)Cc2ccccn2)cc(CN(Cc2ccccn2)Cc2ccccn2)c1)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C49H55N7O5/c1-49(2,3)61-48(59)56(33-38-18-20-41(21-19-38)47(57)58)26-12-13-27-60-46-29-39(31-54(34-42-14-4-8-22-50-42)35-43-15-5-9-23-51-43)28-40(30-46)32-55(36-44-16-6-10-24-52-44)37-45-17-7-11-25-53-45/h4-11,14-25,28-30H,12-13,26-27,31-37H2,1-3H3,(H,57,58) |
| InChIKey | KABGAZDVGDBGOM-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 134.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.02 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|