C25H31N2O9P — CID 118534815
methyl 2-[[(1R,6S)-6-[(3-benzoyl-5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclohex-3-en-1-yl]methoxy]-2-dimethoxyphosphorylacetate (PubChem CID 118534815) has the molecular formula C25H31N2O9P and a molecular weight of 534.50 g/mol. Its IUPAC name is methyl 2-[[(1R,6S)-6-[(3-benzoyl-5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclohex-3-en-1-yl]methoxy]-2-dimethoxyphosphorylacetate.
| Compound Name | methyl 2-[[(1R,6S)-6-[(3-benzoyl-5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclohex-3-en-1-yl]methoxy]-2-dimethoxyphosphorylacetate |
|---|---|
| PubChem CID | 118534815 |
| Molecular Formula | C25H31N2O9P |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | methyl 2-[[(1R,6S)-6-[(3-benzoyl-5-methyl-2,4-dioxopyrimidin-1-yl)methyl]cyclohex-3-en-1-yl]methoxy]-2-dimethoxyphosphorylacetate |
| SMILES | COC(=O)C(OC[C@@H]1CC=CC[C@@H]1Cn1cc(C)c(=O)n(C(=O)c2ccccc2)c1=O)P(=O)(OC)OC |
| InChI | InChI=1S/C25H31N2O9P/c1-17-14-26(25(31)27(21(17)28)22(29)18-10-6-5-7-11-18)15-19-12-8-9-13-20(19)16-36-24(23(30)33-2)37(32,34-3)35-4/h5-11,14,19-20,24H,12-13,15-16H2,1-4H3/t19-,20+,24?/m1/s1 |
| InChIKey | PYUYPDVZWMLQIS-HVUWCZLESA-N |
| XLogP | 2.59 |
| TPSA | 132.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|