C30H34F2N6O3S — CID 118535043
N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-methylsulfonylcyclohexyl]-3-pyridinyl]-2-[2,6-difluoro-4-(oxan-4-yl)phenyl]imidazo[1,5-b]pyridazin-7-amine (PubChem CID 118535043) has the molecular formula C30H34F2N6O3S and a molecular weight of 596.70 g/mol. Its IUPAC name is N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-methylsulfonylcyclohexyl]-3-pyridinyl]-2-[2,6-difluoro-4-(oxan-4-yl)phenyl]imidazo[1,5-b]pyridazin-7-amine.
| Compound Name | N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-methylsulfonylcyclohexyl]-3-pyridinyl]-2-[2,6-difluoro-4-(oxan-4-yl)phenyl]imidazo[1,5-b]pyridazin-7-amine |
|---|---|
| PubChem CID | 118535043 |
| Molecular Formula | C30H34F2N6O3S |
| Molecular Weight | 596.70 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-methylsulfonylcyclohexyl]-3-pyridinyl]-2-[2,6-difluoro-4-(oxan-4-yl)phenyl]imidazo[1,5-b]pyridazin-7-amine |
| SMILES | C[C@H]1C[C@@H](c2ccncc2Nc2ncc3ccc(-c4c(F)cc(C5CCOCC5)cc4F)nn23)C[C@@H](N)[C@H]1S(C)(=O)=O |
| InChI | InChI=1S/C30H34F2N6O3S/c1-17-11-20(14-25(33)29(17)42(2,39)40)22-5-8-34-16-27(22)36-30-35-15-21-3-4-26(37-38(21)30)28-23(31)12-19(13-24(28)32)18-6-9-41-10-7-18/h3-5,8,12-13,15-18,20,25,29H,6-7,9-11,14,33H2,1-2H3,(H,35,36)/t17-,20+,25+,29-/m0/s1 |
| InChIKey | AJFDHJNVIQVXGJ-UVPAAWPQSA-N |
| XLogP | 4.96 |
| TPSA | 124.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.70 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |