About (3S,4R)-3-sulfanylcyclohexa-1,5-diene-1,4-diol
(3S,4R)-3-sulfanylcyclohexa-1,5-diene-1,4-diol (PubChem CID 118535488) has the molecular formula C6H8O2S
and a molecular weight of 144.19 g/mol. Its IUPAC name is (3S,4R)-3-sulfanylcyclohexa-1,5-diene-1,4-diol.
Molecular Properties
| Compound Name | (3S,4R)-3-sulfanylcyclohexa-1,5-diene-1,4-diol |
| PubChem CID | 118535488 |
| Molecular Formula | C6H8O2S |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.02 |
| IUPAC Name | (3S,4R)-3-sulfanylcyclohexa-1,5-diene-1,4-diol |
| SMILES | OC1=C[C@H](S)[C@H](O)C=C1 |
| InChI | InChI=1S/C6H8O2S/c7-4-1-2-5(8)6(9)3-4/h1-3,5-9H/t5-,6+/m1/s1 |
| InChIKey | BTMLUKLTCDVOCZ-RITPCOANSA-N |
| XLogP | 0.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3S,4R)-3-sulfanylcyclohexa-1,5-diene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-3-sulfanylcyclohexa-1,5-diene-1,4-diol?
The IUPAC name of (3S,4R)-3-sulfanylcyclohexa-1,5-diene-1,4-diol (CID 118535488) is (3S,4R)-3-sulfanylcyclohexa-1,5-diene-1,4-diol.
What is the SMILES notation for (3S,4R)-3-sulfanylcyclohexa-1,5-diene-1,4-diol?
The canonical SMILES for (3S,4R)-3-sulfanylcyclohexa-1,5-diene-1,4-diol is OC1=C[C@H](S)[C@H](O)C=C1.
What is the InChIKey of (3S,4R)-3-sulfanylcyclohexa-1,5-diene-1,4-diol?
The InChIKey is BTMLUKLTCDVOCZ-RITPCOANSA-N. The full InChI is InChI=1S/C6H8O2S/c7-4-1-2-5(8)6(9)3-4/h1-3,5-9H/t5-,6+/m1/s1.
What are the key properties of (3S,4R)-3-sulfanylcyclohexa-1,5-diene-1,4-diol?
(3S,4R)-3-sulfanylcyclohexa-1,5-diene-1,4-diol has a molecular weight of 144.19 g/mol, XLogP of 0.66, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-3-sulfanylcyclohexa-1,5-diene-1,4-diol is sourced from PubChem (CID 118535488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).