C21H30F6O2 — CID 118535898
2-[3-(2,2-dimethylbutyl)-4-methoxy-5-(2-methylbutan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 118535898) has the molecular formula C21H30F6O2 and a molecular weight of 428.46 g/mol. Its IUPAC name is 2-[3-(2,2-dimethylbutyl)-4-methoxy-5-(2-methylbutan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-(2,2-dimethylbutyl)-4-methoxy-5-(2-methylbutan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 118535898 |
| Molecular Formula | C21H30F6O2 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 2-[3-(2,2-dimethylbutyl)-4-methoxy-5-(2-methylbutan-2-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCC(C)(C)Cc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(C(C)(C)CC)c1OC |
| InChI | InChI=1S/C21H30F6O2/c1-8-17(3,4)12-13-10-14(19(28,20(22,23)24)21(25,26)27)11-15(16(13)29-7)18(5,6)9-2/h10-11,28H,8-9,12H2,1-7H3 |
| InChIKey | OZZQDKPCPOWFHK-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |