About dimethyl-(1,3,6-trimethyl-4H-pyrimidin-2-ylidene)azanium
dimethyl-(1,3,6-trimethyl-4H-pyrimidin-2-ylidene)azanium (PubChem CID 118535987) has the molecular formula C9H18N3+
and a molecular weight of 168.26 g/mol. Its IUPAC name is dimethyl-(1,3,6-trimethyl-4H-pyrimidin-2-ylidene)azanium.
Molecular Properties
| Compound Name | dimethyl-(1,3,6-trimethyl-4H-pyrimidin-2-ylidene)azanium |
| PubChem CID | 118535987 |
| Molecular Formula | C9H18N3+ |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | dimethyl-(1,3,6-trimethyl-4H-pyrimidin-2-ylidene)azanium |
| SMILES | CC1=CCN(C)C(=[N+](C)C)N1C |
| InChI | InChI=1S/C9H18N3/c1-8-6-7-11(4)9(10(2)3)12(8)5/h6H,7H2,1-5H3/q+1 |
| InChIKey | LPHBKBIPXAFXER-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-(1,3,6-trimethyl-4H-pyrimidin-2-ylidene)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-(1,3,6-trimethyl-4H-pyrimidin-2-ylidene)azanium?
The IUPAC name of dimethyl-(1,3,6-trimethyl-4H-pyrimidin-2-ylidene)azanium (CID 118535987) is dimethyl-(1,3,6-trimethyl-4H-pyrimidin-2-ylidene)azanium.
What is the SMILES notation for dimethyl-(1,3,6-trimethyl-4H-pyrimidin-2-ylidene)azanium?
The canonical SMILES for dimethyl-(1,3,6-trimethyl-4H-pyrimidin-2-ylidene)azanium is CC1=CCN(C)C(=[N+](C)C)N1C.
What is the InChIKey of dimethyl-(1,3,6-trimethyl-4H-pyrimidin-2-ylidene)azanium?
The InChIKey is LPHBKBIPXAFXER-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N3/c1-8-6-7-11(4)9(10(2)3)12(8)5/h6H,7H2,1-5H3/q+1.
What are the key properties of dimethyl-(1,3,6-trimethyl-4H-pyrimidin-2-ylidene)azanium?
dimethyl-(1,3,6-trimethyl-4H-pyrimidin-2-ylidene)azanium has a molecular weight of 168.26 g/mol, XLogP of 0.40, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-(1,3,6-trimethyl-4H-pyrimidin-2-ylidene)azanium is sourced from PubChem (CID 118535987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).