C18H36O2 — CID 118536069
tert-butyl 3,5-dimethyldodecanoate (PubChem CID 118536069) has the molecular formula C18H36O2 and a molecular weight of 284.48 g/mol. Its IUPAC name is tert-butyl 3,5-dimethyldodecanoate.
| Compound Name | tert-butyl 3,5-dimethyldodecanoate |
|---|---|
| PubChem CID | 118536069 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.27 |
| IUPAC Name | tert-butyl 3,5-dimethyldodecanoate |
| SMILES | CCCCCCCC(C)CC(C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H36O2/c1-7-8-9-10-11-12-15(2)13-16(3)14-17(19)20-18(4,5)6/h15-16H,7-14H2,1-6H3 |
| InChIKey | FZPMHVQLTAINSS-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|