C13H10F3NO5 — CID 118536836
5-[[phenyl(trifluoromethoxy)methoxy]methyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 118536836) has the molecular formula C13H10F3NO5 and a molecular weight of 317.22 g/mol. Its IUPAC name is 5-[[phenyl(trifluoromethoxy)methoxy]methyl]-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[[phenyl(trifluoromethoxy)methoxy]methyl]-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 118536836 |
| Molecular Formula | C13H10F3NO5 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 5-[[phenyl(trifluoromethoxy)methoxy]methyl]-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(COC(OC(F)(F)F)c2ccccc2)on1 |
| InChI | InChI=1S/C13H10F3NO5/c14-13(15,16)21-12(8-4-2-1-3-5-8)20-7-9-6-10(11(18)19)17-22-9/h1-6,12H,7H2,(H,18,19) |
| InChIKey | HLUQZKJOASOZTJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|