About 3,4-dibutyl-1-ethoxy-8-methyl-2,1λ5-benzoxaphosphinine 1-oxide
3,4-dibutyl-1-ethoxy-8-methyl-2,1λ5-benzoxaphosphinine 1-oxide (PubChem CID 118536862) has the molecular formula C19H29O3P
and a molecular weight of 336.41 g/mol. Its IUPAC name is 3,4-dibutyl-1-ethoxy-8-methyl-2,1λ5-benzoxaphosphinine 1-oxide.
Molecular Properties
| Compound Name | 3,4-dibutyl-1-ethoxy-8-methyl-2,1λ5-benzoxaphosphinine 1-oxide |
| PubChem CID | 118536862 |
| Molecular Formula | C19H29O3P |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 3,4-dibutyl-1-ethoxy-8-methyl-2,1λ5-benzoxaphosphinine 1-oxide |
| SMILES | CCCCC1=C(CCCC)c2cccc(C)c2P(=O)(OCC)O1 |
| InChI | InChI=1S/C19H29O3P/c1-5-8-12-16-17-13-10-11-15(4)19(17)23(20,21-7-3)22-18(16)14-9-6-2/h10-11,13H,5-9,12,14H2,1-4H3 |
| InChIKey | BHVULQZFQQHSJR-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dibutyl-1-ethoxy-8-methyl-2,1λ5-benzoxaphosphinine 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibutyl-1-ethoxy-8-methyl-2,1λ5-benzoxaphosphinine 1-oxide?
The IUPAC name of 3,4-dibutyl-1-ethoxy-8-methyl-2,1λ5-benzoxaphosphinine 1-oxide (CID 118536862) is 3,4-dibutyl-1-ethoxy-8-methyl-2,1λ5-benzoxaphosphinine 1-oxide.
What is the SMILES notation for 3,4-dibutyl-1-ethoxy-8-methyl-2,1λ5-benzoxaphosphinine 1-oxide?
The canonical SMILES for 3,4-dibutyl-1-ethoxy-8-methyl-2,1λ5-benzoxaphosphinine 1-oxide is CCCCC1=C(CCCC)c2cccc(C)c2P(=O)(OCC)O1.
What is the InChIKey of 3,4-dibutyl-1-ethoxy-8-methyl-2,1λ5-benzoxaphosphinine 1-oxide?
The InChIKey is BHVULQZFQQHSJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29O3P/c1-5-8-12-16-17-13-10-11-15(4)19(17)23(20,21-7-3)22-18(16)14-9-6-2/h10-11,13H,5-9,12,14H2,1-4H3.
What are the key properties of 3,4-dibutyl-1-ethoxy-8-methyl-2,1λ5-benzoxaphosphinine 1-oxide?
3,4-dibutyl-1-ethoxy-8-methyl-2,1λ5-benzoxaphosphinine 1-oxide has a molecular weight of 336.41 g/mol, XLogP of 5.97, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibutyl-1-ethoxy-8-methyl-2,1λ5-benzoxaphosphinine 1-oxide is sourced from PubChem (CID 118536862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).