C28H36N12 — CID 118536927
1,4,7,10-tetrakis(pyrimidin-4-ylmethyl)-1,4,7,10-tetrazacyclododecane (PubChem CID 118536927) has the molecular formula C28H36N12 and a molecular weight of 540.68 g/mol. Its IUPAC name is 1,4,7,10-tetrakis(pyrimidin-4-ylmethyl)-1,4,7,10-tetrazacyclododecane.
| Compound Name | 1,4,7,10-tetrakis(pyrimidin-4-ylmethyl)-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 118536927 |
| Molecular Formula | C28H36N12 |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | 1,4,7,10-tetrakis(pyrimidin-4-ylmethyl)-1,4,7,10-tetrazacyclododecane |
| SMILES | c1cc(CN2CCN(Cc3ccncn3)CCN(Cc3ccncn3)CCN(Cc3ccncn3)CC2)ncn1 |
| InChI | InChI=1S/C28H36N12/c1-5-29-21-33-25(1)17-37-9-11-38(18-26-2-6-30-22-34-26)13-15-40(20-28-4-8-32-24-36-28)16-14-39(12-10-37)19-27-3-7-31-23-35-27/h1-8,21-24H,9-20H2 |
| InChIKey | FHOIBHNPMZWRDQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 116.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |