C29H28N4O3 — CID 118537354
2-[(3-methyloxetan-3-yl)methoxy]-5-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]benzonitrile (PubChem CID 118537354) has the molecular formula C29H28N4O3 and a molecular weight of 480.57 g/mol. Its IUPAC name is 2-[(3-methyloxetan-3-yl)methoxy]-5-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]benzonitrile.
| Compound Name | 2-[(3-methyloxetan-3-yl)methoxy]-5-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 118537354 |
| Molecular Formula | C29H28N4O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 2-[(3-methyloxetan-3-yl)methoxy]-5-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]benzonitrile |
| SMILES | CC1(COc2ccc(-c3ccnc4[nH]c(-c5ccc(N6CCOCC6)cc5)cc34)cc2C#N)COC1 |
| InChI | InChI=1S/C29H28N4O3/c1-29(17-35-18-29)19-36-27-7-4-21(14-22(27)16-30)24-8-9-31-28-25(24)15-26(32-28)20-2-5-23(6-3-20)33-10-12-34-13-11-33/h2-9,14-15H,10-13,17-19H2,1H3,(H,31,32) |
| InChIKey | MAHDAWIVQYOKQJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|