C30H30F2N8O2 — CID 118537399
2-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxy-5-[8-[4-(4-methylpiperazin-1-yl)phenyl]-7H-purin-6-yl]benzonitrile (PubChem CID 118537399) has the molecular formula C30H30F2N8O2 and a molecular weight of 572.62 g/mol. Its IUPAC name is 2-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxy-5-[8-[4-(4-methylpiperazin-1-yl)phenyl]-7H-purin-6-yl]benzonitrile.
| Compound Name | 2-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxy-5-[8-[4-(4-methylpiperazin-1-yl)phenyl]-7H-purin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 118537399 |
| Molecular Formula | C30H30F2N8O2 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | 2-[1-(2,2-difluoroacetyl)piperidin-4-yl]oxy-5-[8-[4-(4-methylpiperazin-1-yl)phenyl]-7H-purin-6-yl]benzonitrile |
| SMILES | CN1CCN(c2ccc(-c3nc4ncnc(-c5ccc(OC6CCN(C(=O)C(F)F)CC6)c(C#N)c5)c4[nH]3)cc2)CC1 |
| InChI | InChI=1S/C30H30F2N8O2/c1-38-12-14-39(15-13-38)22-5-2-19(3-6-22)28-36-26-25(34-18-35-29(26)37-28)20-4-7-24(21(16-20)17-33)42-23-8-10-40(11-9-23)30(41)27(31)32/h2-7,16,18,23,27H,8-15H2,1H3,(H,34,35,36,37) |
| InChIKey | WJAQTTIMBYEQHZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|