C28H27N5O4S — CID 118537408
2-(1,1-dioxothian-4-yl)oxy-5-[6-(4-morpholin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]benzonitrile (PubChem CID 118537408) has the molecular formula C28H27N5O4S and a molecular weight of 529.62 g/mol. Its IUPAC name is 2-(1,1-dioxothian-4-yl)oxy-5-[6-(4-morpholin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]benzonitrile.
| Compound Name | 2-(1,1-dioxothian-4-yl)oxy-5-[6-(4-morpholin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 118537408 |
| Molecular Formula | C28H27N5O4S |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | 2-(1,1-dioxothian-4-yl)oxy-5-[6-(4-morpholin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2ncnc3[nH]c(-c4ccc(N5CCOCC5)cc4)cc23)ccc1OC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C28H27N5O4S/c29-17-21-15-20(3-6-26(21)37-23-7-13-38(34,35)14-8-23)27-24-16-25(32-28(24)31-18-30-27)19-1-4-22(5-2-19)33-9-11-36-12-10-33/h1-6,15-16,18,23H,7-14H2,(H,30,31,32) |
| InChIKey | YUYWEMINLXEHCX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 121.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|