C30H27N7O3 — CID 118537543
2-[(3R)-1-(2-cyanoacetyl)pyrrolidin-3-yl]oxy-5-[6-(4-morpholin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]benzonitrile (PubChem CID 118537543) has the molecular formula C30H27N7O3 and a molecular weight of 533.59 g/mol. Its IUPAC name is 2-[(3R)-1-(2-cyanoacetyl)pyrrolidin-3-yl]oxy-5-[6-(4-morpholin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]benzonitrile.
| Compound Name | 2-[(3R)-1-(2-cyanoacetyl)pyrrolidin-3-yl]oxy-5-[6-(4-morpholin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 118537543 |
| Molecular Formula | C30H27N7O3 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 2-[(3R)-1-(2-cyanoacetyl)pyrrolidin-3-yl]oxy-5-[6-(4-morpholin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]benzonitrile |
| SMILES | N#CCC(=O)N1CC[C@@H](Oc2ccc(-c3ncnc4[nH]c(-c5ccc(N6CCOCC6)cc5)cc34)cc2C#N)C1 |
| InChI | InChI=1S/C30H27N7O3/c31-9-7-28(38)37-10-8-24(18-37)40-27-6-3-21(15-22(27)17-32)29-25-16-26(35-30(25)34-19-33-29)20-1-4-23(5-2-20)36-11-13-39-14-12-36/h1-6,15-16,19,24H,7-8,10-14,18H2,(H,33,34,35)/t24-/m1/s1 |
| InChIKey | OXGWASRCNSKLEZ-XMMPIXPASA-N |
| XLogP | 3.89 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|