C31H30F3N7O2 — CID 118537562
2-(1-formylpiperidin-4-yl)oxy-5-[8-[4-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]phenyl]-7H-purin-6-yl]benzonitrile (PubChem CID 118537562) has the molecular formula C31H30F3N7O2 and a molecular weight of 589.62 g/mol. Its IUPAC name is 2-(1-formylpiperidin-4-yl)oxy-5-[8-[4-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]phenyl]-7H-purin-6-yl]benzonitrile.
| Compound Name | 2-(1-formylpiperidin-4-yl)oxy-5-[8-[4-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]phenyl]-7H-purin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 118537562 |
| Molecular Formula | C31H30F3N7O2 |
| Molecular Weight | 589.62 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | 2-(1-formylpiperidin-4-yl)oxy-5-[8-[4-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]phenyl]-7H-purin-6-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2ncnc3nc(-c4ccc(C5CCN(CC(F)(F)F)CC5)cc4)[nH]c23)ccc1OC1CCN(C=O)CC1 |
| InChI | InChI=1S/C31H30F3N7O2/c32-31(33,34)17-40-11-7-21(8-12-40)20-1-3-22(4-2-20)29-38-28-27(36-18-37-30(28)39-29)23-5-6-26(24(15-23)16-35)43-25-9-13-41(19-42)14-10-25/h1-6,15,18-19,21,25H,7-14,17H2,(H,36,37,38,39) |
| InChIKey | WISWDBLLYNYCRE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.62 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|