C29H30F2N8O — CID 118537610
5-[8-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]phenyl]-7H-purin-6-yl]-2-piperidin-4-yloxybenzonitrile (PubChem CID 118537610) has the molecular formula C29H30F2N8O and a molecular weight of 544.61 g/mol. Its IUPAC name is 5-[8-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]phenyl]-7H-purin-6-yl]-2-piperidin-4-yloxybenzonitrile.
| Compound Name | 5-[8-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]phenyl]-7H-purin-6-yl]-2-piperidin-4-yloxybenzonitrile |
|---|---|
| PubChem CID | 118537610 |
| Molecular Formula | C29H30F2N8O |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 5-[8-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]phenyl]-7H-purin-6-yl]-2-piperidin-4-yloxybenzonitrile |
| SMILES | N#Cc1cc(-c2ncnc3nc(-c4ccc(N5CCN(CC(F)F)CC5)cc4)[nH]c23)ccc1OC1CCNCC1 |
| InChI | InChI=1S/C29H30F2N8O/c30-25(31)17-38-11-13-39(14-12-38)22-4-1-19(2-5-22)28-36-27-26(34-18-35-29(27)37-28)20-3-6-24(21(15-20)16-32)40-23-7-9-33-10-8-23/h1-6,15,18,23,25,33H,7-14,17H2,(H,34,35,36,37) |
| InChIKey | GEMZAQKPULZSJL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 105.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|