C31H28N6O3 — CID 118537705
2-[(3S)-1-(2-cyanoacetyl)pyrrolidin-3-yl]oxy-5-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]benzonitrile (PubChem CID 118537705) has the molecular formula C31H28N6O3 and a molecular weight of 532.60 g/mol. Its IUPAC name is 2-[(3S)-1-(2-cyanoacetyl)pyrrolidin-3-yl]oxy-5-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]benzonitrile.
| Compound Name | 2-[(3S)-1-(2-cyanoacetyl)pyrrolidin-3-yl]oxy-5-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 118537705 |
| Molecular Formula | C31H28N6O3 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 2-[(3S)-1-(2-cyanoacetyl)pyrrolidin-3-yl]oxy-5-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]benzonitrile |
| SMILES | N#CCC(=O)N1CC[C@H](Oc2ccc(-c3ccnc4[nH]c(-c5ccc(N6CCOCC6)cc5)cc34)cc2C#N)C1 |
| InChI | InChI=1S/C31H28N6O3/c32-10-7-30(38)37-12-9-25(20-37)40-29-6-3-22(17-23(29)19-33)26-8-11-34-31-27(26)18-28(35-31)21-1-4-24(5-2-21)36-13-15-39-16-14-36/h1-6,8,11,17-18,25H,7,9,12-16,20H2,(H,34,35)/t25-/m0/s1 |
| InChIKey | WMAOLQILCBAPMK-VWLOTQADSA-N |
| XLogP | 4.50 |
| TPSA | 118.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|