C18H17ClF3N5 — CID 118537728
6-chloro-8-[4-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]phenyl]-7H-purine (PubChem CID 118537728) has the molecular formula C18H17ClF3N5 and a molecular weight of 395.82 g/mol. Its IUPAC name is 6-chloro-8-[4-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]phenyl]-7H-purine.
| Compound Name | 6-chloro-8-[4-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]phenyl]-7H-purine |
|---|---|
| PubChem CID | 118537728 |
| Molecular Formula | C18H17ClF3N5 |
| Molecular Weight | 395.82 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 6-chloro-8-[4-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]phenyl]-7H-purine |
| SMILES | FC(F)(F)CN1CCC(c2ccc(-c3nc4ncnc(Cl)c4[nH]3)cc2)CC1 |
| InChI | InChI=1S/C18H17ClF3N5/c19-15-14-17(24-10-23-15)26-16(25-14)13-3-1-11(2-4-13)12-5-7-27(8-6-12)9-18(20,21)22/h1-4,10,12H,5-9H2,(H,23,24,25,26) |
| InChIKey | OCMZXNLTBHRGMC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.82 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |